ОКИСЛИТЕЛЬНО-ВОССТАНОВИТЕЛЬНЫЕ РЕАКЦИИ

 

Степень окисления

 

Степень окисления - это условный заряд атома в молекуле, вычисленный в предположении, что молекула состоит из ионов и в целом электронейтральна.

Наиболее электроотрицательные элементы в соединении имеют отрицательные степени окисления, а атомы элементов с меньшей электроотрицательностью - положительные.

Степень окисления - формальное понятие; в ряде случаев степень окисления не совпадает с валентностью.

 

Например:

N2H4 (гидразин)

 

 

степень окисления азота – -2; валентность азота – 3.

 

Расчет степени окисления

 

Для вычисления степени окисления элемента следует учитывать следующие положения:

 

1.      Степени окисления атомов в простых веществах равны нулю (Na0; H20).

 

2.      Алгебраическая сумма степеней окисления всех атомов, входящих в состав молекулы, всегда равна нулю, а в сложном ионе эта сумма равна заряду иона.

 

3.      Постоянную степень окисления имеют атомы: щелочных металлов (+1), щелочноземельных металлов (+2), водорода (+1) (кроме гидридов NaH, CaH2 и др., где степень окисления водорода -1), кислорода (-2) (кроме F2-1O+2 и пероксидов, содержащих группу OO, в которой степень окисления кислорода -1).

 

4.      Для элементов положительная степень окисления не может превышать величину, равную номеру группы периодической системы.

 

Примеры:

V2+5O5-2;  Na2+1B4+3O7-2;  K+1Cl+7O4-2;  N-3H3+1;  K2+1H+1P+5O4-2;  Na2+1Cr2+6O7-2

 

Реакции без и с изменением степени окисления

 

Существует два типа химических реакций:

 

A       Реакции, в которых не изменяется степень окисления элементов:

 

Реакции присоединения

SO2 + Na2O ® Na2SO3

Реакции разложения

Cu(OH)2  –t°®  CuO + H2O

Реакции обмена

AgNO3 + KCl ® AgCl¯ + KNO3

NaOH + HNO3 ® NaNO3 + H2O

 

B      Реакции, в которых происходит изменение степеней окисления атомов элементов, входящих в состав реагирующих соединений:

 

2Mg0 + O20 ® 2Mg+2O-2

2KCl+5O3-2  –t°®  2KCl-1 + 3O20­

2KI-1 + Cl20 ® 2KCl-1 + I20

Mn+4O2 + 4HCl-1 ® Mn+2Cl2 + Cl20­ + 2H2O

 

Такие реакции называются окислительно - восстановительными.

 

Окисление, восстановление

 

В окислительно-восстановительных реакциях электроны от одних атомов, молекул или ионов переходят к другим. Процесс отдачи электронов - окисление. При окислении степень окисления повышается:

 

H20 - 2ē ® 2H+

S-2 - 2ē ® S0

Al0 - 3ē ® Al+3

Fe+2 - ē ® Fe+3

2Br - - 2ē ® Br20

 

Процесс присоединения электронов - восстановление: При восстановлении степень окисления понижается.

 

Mn+4 + 2ē ® Mn+2

S0 + 2ē ® S-2

Cr+6 +3ē ® Cr+3

Cl20 +2ē ® 2Cl-

O20 + 4ē ® 2O-2

 

Атомы или ионы, которые в данной реакции присоединяют электроны являются окислителями, а которые отдают электроны - восстановителями.

 

Окислительно-восстановительные свойства вещества и степени окисления входящих в него атомов

 

Соединения, содержащие атомы элементов с максимальной степенью окисления, могут быть только окислителями за счет этих атомов, т.к. они уже отдали все свои валентные электроны и способны только принимать электроны. Максимальная степень окисления атома элемента равна номеру группы в периодической таблице, к которой относится данный элемент. Соединения, содержащие атомы элементов с минимальной степенью окисления могут служить только восстановителями, поскольку они способны лишь отдавать электроны, потому, что внешний энергетический уровень у таких атомов завершен восемью электронами. Минимальная степень окисления у атомов металлов равна 0, для неметаллов - (n–8) (где n- номер группы в периодической системе). Соединения, содержащие атомы элементов с промежуточной степенью окисления, могут быть и окислителями и восстановителями, в зависимости от партнера, с которым взаимодействуют и от условий реакции.

 

Важнейшие восстановители и окислители

 

Восстановители

Окислители

Металлы,

водород,

уголь.

Окись углерода (II) (CO).

Сероводород (H2S);

оксид серы (IV) (SO2);

сернистая кислота H2SO3 и ее соли.

Галогеноводородные кислоты и их соли.

Катионы металлов в низших степенях окисления: SnCl2, FeCl2, MnSO4, Cr2(SO4)3.

Азотистая кислота HNO2;

аммиак NH3;

гидразин NH2NH2;

оксид азота(II) (NO).

Катод при электролизе.

Галогены.

Перманганат калия(KMnO4);

манганат калия (K2MnO4);

оксид марганца (IV) (MnO2).

Дихромат калия (K2Cr2O7);

хромат калия (K2CrO4).

Азотная кислота (HNO3).

Серная кислота (H2SO4) конц.

Оксид меди(II) (CuO);

оксид свинца(IV) (PbO2);

оксид серебра (Ag2O);

пероксид водорода (H2O2).

Хлорид железа(III) (FeCl3).

Бертоллетова соль (KClO3).

Анод при электролизе.

 

Классификация окислительно-восстановительных реакций

 

Межмолекулярные окислительно-восстановительные реакции

 

Окислитель и восстановитель находятся в разных веществах; обмен электронами в этих реакциях происходит между различными атомами или молекулами:

 

S0 + O20 ® S+4O2-2

S - восстановитель; O2 - окислитель

 

Cu+2O + C+2O ® Cu0 + C+4O2

CO - восстановитель; CuO - окислитель

 

Zn0 + 2HCl ® Zn+2Cl2 + H20­

Zn - восстановитель; HСl - окислитель

 

Mn+4O2 + 2KI-1 + 2H2SO4  ®  I20 + K2SO4 + Mn+2SO4 + 2H2O

KI - восстановитель; MnO2 - окислитель.

 

Сюда же относятся реакции между веществами, в которых атомы одного и того же элемента имеют разные степени окисления

 

2H2S-2 + H2S+4O3 ® 3S0 + 3H2O

 

Внутримолекулярные окислительно- восстановительные реакции

 

Во внутримолекулярных реакциях окислитель и восстановитель находятся в одной и той же молекуле. Внутримолекулярные реакции протекают, как правило, при термическом разложении веществ, содержащих окислитель и восстановитель.

 

2KCl+5O3-2 ® 2KCl-1 + 3O20­

Cl+5 - окислитель; О-2 - восстановитель

 

N-3H4N+5O3  –t°®  N2+1O­ + 2H2O

N+5 - окислитель; N-3 - восстановитель

 

2Pb(N+5O3-2)2 ® 2PbO + 4N+4O2 + O20­

N+5 - окислитель; O-2 - восстановитель

 

Опыт. Разложение дихромата аммония

(N-3H4)2Cr2+6O7 –t°®  Cr2+3O3 + N20­ + 4H2O

Cr+6 - окислитель; N-3 - восстановитель.

 

Диспропорционирование - окислительно-восстановительная реакция, в которой один элемент одновременно повышает и понижает степень окисления.

 

Cl20 + 2KOH ® KCl+1O + KCl-1 + H2O

3K2Mn+6O4 + 2H2O ® 2KMn+7O4 + Mn+4O2 + 4KOH

3HN+3O2 ® HN+5O3 + 2N+2O­ + H2O

2N+4O2 + 2KOH ® KN+5O3 + KN+3O2 + H2O

 

Составление уравнений окислительно-восстановительных реакций

 

A       Электронный баланс - метод нахождения коэффициентов в уравнениях окислительно-восстановительных реакций, в котором рассматривается обмен электронами между атомами элементов, изменяющих свою степень окисления. Число электронов, отданное восстановителем равно числу электронов, получаемых окислителем.

 

Уравнение составляется в несколько стадий:

 

1.      Записывают схему реакции.

 

KMnO4 + HCl ® KCl + MnCl2 + Cl2­ + H2O

 

2.      Проставляют степени окисления над знаками элементов, которые меняются.

 

KMn+7O4 + HCl-1 ® KCl + Mn+2Cl2 + Cl20­ + H2O

 

3.      Выделяют элементы, изменяющие степени окисления и определяют число электронов, приобретенных окислителем и отдаваемых восстановителем.

 

Mn+7 + 5ē ® Mn+2

2Cl-1 - 2ē ® Cl20

 

4.      Уравнивают число приобретенных и отдаваемых электронов, устанавливая тем самым коэффициенты для соединений, в которых присутствуют элементы, изменяющие степень окисления.

 

Mn+7 + 5ē ® Mn+2

2

2Cl-1 - 2ē ® Cl20

5

––––––––––––––––––––––––

2Mn+7 + 10Cl-1 ® 2Mn+2 + 5Cl20

 

5.      Подбирают коэффициенты для всех остальных участников реакции.

 

2KMn+7O4 + 16HCl-1 ® 2KCl + 2Mn+2Cl2 + 5Cl20 + 8H2O

 

B      Электронно-ионный баланс (метод полуреакций) метод нахождения коэффициентов, в котором рассматривается обмен электронами между ионами в растворе с учетом характера среды:

 

2Cl1- –  2ē ®

Cl20

 

 5

MnO41- + 8H+

+ 5ē ®

Mn2+ + 4H2O

 2

7+

 

2+

 

––––––––––––––––––––––––––––––––––––––

10Cl- + 2MnO41- + 16H+ ® 5Cl20­ + 2Mn2+ + 8H2O

(для уравнивания ионной полуреакции используют H+, OH- или воду)

 

Типичные реакции окисления-восстановления

 

Реакции с участием перманганата калия в качестве окислителя

 

При взаимодействии перманганата калия с восстановителем образуются различные продукты восстановления в зависимости от pH среды.

 

Реакции в кислой среде.

 

5K2S+4O3 + 2KMn+7O4 + 3H2SO4 ® 6K2S+6O4 + 2Mn+2SO4 + 3H2O

 

электронный баланс

Mn+7 + 5ē ® Mn+2

2

S+4 – 2ē ® S+6

5

 

метод полуреакций

MnO4- + 8H+ + 5ē ® Mn2+ + 4H2O

2

SO32- + H2O – 2ē ® SO42- + 2H+

5

–––––––––––––––––––––––––––––––––––––––––––––––––––

2MnO4- + 16H+ + 5SO32- + 5H2O ® 2Mn2+ + 8H2O + 5SO42- + 10H+

или 2MnO4- + 6H+ + 5SO32- ® 2Mn2+ + 3H2O + 5SO42-

 

Фиолетовый раствор KMnO4 обесцвечивается при добавлении раствора K2SO3.

 
Реакции в нейтральной среде

 

3K2S+4O3 + 2KMn+7O4 + H2O ® 3K2S+6O4 +2Mn+4O2¯ + 2KOH

 

электронный баланс

S+4 – 2ē ® S+6

3

Mn+7 + 3ē ® Mn+4

2

 

метод полуреакций:

MnO41- + 2H2O + 3ē ® MnO2 + 4OH-

2

SO32- + 2OH- - 2ē ® SO42- + H2O

3

–––––––––––––––––––––––––––––––––––––––––––––––––––

2MnO4- + 4H2O + 3SO32- + 6OH- ® 2MnO2 + 8OH- + 3SO42- + 3H2O

или 2MnO4- + H2O + 3SO32- ® 2MnO2 + 2OH- + 3SO42-

 

Фиолетовый раствор KMnO4 после окончания реакции обесцвечивается и наблюдается выпадение бурого осадка.

 

Реакции в щелочной среде.

 

K2S+4O3 + 2KMn+7O4 + 2KOH ® K2S+6O4 +2K2Mn+6O4 + H2O

 

электронный баланс

S+4 – 2ē ® S+6

1

Mn+7 + 1ē ® Mn+6

2

 

метод полуреакций:

SO32- + 2OH- - 2ē ® SO42- + H2O

1

MnO41- + ē ® MnO42-

2

–––––––––––––––––––––––––––––––––––––

SO32- + 2OH- + 2MnO4- ® SO42- + H2O + 2MnO42-

 

Фиолетовый раствор KMnO4 превращается в зеленоватый раствор K2MnO4.

Таким образом,

 

Реакции с дихроматом калия в качестве окислителя

 

Степень окисления хрома понижается с +6 до +3. Наблюдается изменение окраски реакционной массы с желто-оранжевого цвета до зеленого или фиолетового.

 

1)      

K2Cr2+6O7 + 3H2S-2 + 4H2SO4 ® K2SO4 + Cr2+3(SO4)3 + 3S0¯ + 7H2O

 

электронный баланс:

2Cr+6 + 6ē ® 2Cr+3

1

S-2 - 2ē ® S0

3

 

метод полуреакций:

Cr2O72- + 14H+ + 6ē ® 2Cr3+ + 7H2O

1

H2S0 - 2ē ® S0 + 2H+

3

––––––––––––––––––––––––––––––––––

Cr2O72- + 8H+ + 3H2S ® 2Cr3+ + 7H2O + 3S0

 

2)      

K2Cr2+6O7 + 6Fe+2SO4 + 7H2SO4 ® 3Fe2+3(SO4)3 + K2SO4 + Cr2+3(SO4)3 + 7H2O

 

электронный баланс:

2Cr+6 + 6ē ® 2Cr+3

1

Fe+2 – ē ® Fe+3

6

 

метод полуреакций:

Cr2O72- + 14H+ + 6ē ® 2Cr3+ + 7H2O

1

Fe2+ - ē ® Fe3+

6

–––––––––––––––––––––––––––––––––––––

6Fe2+ + Cr2O72- + 14H+ ® 2Cr3+ + 6Fe3+ + 7H2O

 

3)      

K2Cr2+6O7 + 14HCl-1 ® 3Cl20­ + 2KCl + 2Cr+3Cl3 + 7H2O

 

электронный баланс:

2Cr+6 + 6ē ® 2Cr+3

1

2Cl-1 – 2ē ® Cl20

3

 

метод полуреакций:

Cr2O72- + 14H+ + 6ē ® 2Cr3+ + 7H2O

1

2Cl1- - 2ē ® Cl20

3

–––––––––––––––––––––––––––––––––––

Cr2O72- + 6Cl- + 14H+ ® 2Cr3+ + 3Cl20 + 7H2O

 

Окислительные свойства азотной кислоты

 

Окислителем в молекуле (см. также "Азотная кислота") азотной кислоты является N+5, который в зависимости от концентрации HNO3 и силы восстановителя (например, активности металла - см. также тему " Азотная кислота") принимает от 1 до 8 электронов, образуя
N+4O2N+2ON2+1ON20N-3H3(NH4NO3);

 

1)      

Cu0 + 4HN+5O3(конц.) ® Cu+2(NO3)2 + 2N+4O2­ + 2H2O

 

электронный баланс:

Cu0 – 2ē ® Cu+2

1

N+5 + ē ® N+4

2

 

метод полуреакций:

Cu0 – 2ē ® Cu+2

1

NO3- + 2H+ + ē ® NO2 + H2O

2

––––––––––––––––––––––––––––––––

Cu0 + 2NO3- + 4H+ ® Cu2+ + 2NO2 + 2H2O

 

2)      

3Ag0 + 4HN+5O3(конц.) ® 3Ag+1NO3 + N+2O­ + 2H2O

 

электронный баланс:

Ag0 - ē ® Ag+

3

N+5 + 3ē ® N+2

1

 

метод полуреакций:

Ag0 - ē ® Ag+

3

NO3- + 4H+ + 3ē ® NO + 2H2O

1

––––––––––––––––––––––––––––––

3Ag0 + NO3- + 4H+ ® 3Ag+ + NO + 2H2O

 

3)      

5Co0 + 12HN+5O3(разб.) ® 5Co+2(NO3)2 + N20­ + 6H2O

 

электронный баланс:

Co0 - 2ē ® Co+2

5

2N+5 + 10ē ® N20

1

 

метод полуреакций:

Co0 - 2ē ® Co+2

5

2NO3- + 12H+ + 10ē ® N2 + 6H2O

1

–––––––––––––––––––––––––––––––––

5Co0 + 2NO3- + 12H+ ® 5Co2+ + N2 + 6H2O

 

4)      

4Ca0 + 10HN+5O3(оч.разб.) ® 4Ca+2(NO3)2 + N-3H4NO3 + 3H2O

 

электронный баланс:

Ca0 - 2ē ® Ca+2

4

N+5 + 8ē ® N-3

1

 

метод полуреакций:

Ca0 - 2ē ® Ca+2

4

NO3- + 10H+ + 8ē ® NH4+ + 3H2O

1

–––––––––––––––––––––––––––––––––

4Ca0 + NO3- + 10H+ ® 4Ca2+ + NH4+ + 3H2O

 

При взаимодействии HNO3 с неметаллами выделяется, как правило, NO:

 

1)      

3C0 + 4HN+5O3 ® 3C+4O2­ + 4N+2O­ + 2H2O

 

электронный баланс:

C0 - 4ē ® C+4

3

N+5 + 3ē ® N+2

4

метод полуреакций:

C0 + 2H2O - 4ē ® CO2 + 4H+

3

NO3- + 4H+ + 3ē ® NO + 2H2O

4

–––––––––––––––––––––––––––––––––––––––––––––

3C0 + 6H2O + 4NO3- + 16H+ ® 3CO2 + 12H+ + 4NO + 8H2O

или 3C0 + 4NO3- + 4H+ ® 3CO2 + 4NO + 2H2O

 

2)      

3P0 + 5HN+5O3 + 2H2O ® 3H3P+5O4 + 5N+2O­

 

электронный баланс:

P0 - 5ē ® P+5

3

N+5 + 3ē ® N+2

5

метод полуреакций:

P0 + 4H2O - 5ē ® PO43- + 8H+

3

NO3- + 4H+ + 3ē ® NO + 2H2O

5

––––––––––––––––––––––––––––––––––––––––––––––––

3P0 + 12H2O + 5NO3- + 20H+ ® 3PO43- + 24H+ + 5NO + 10H2O

или 3P0 + 2H2O + 5NO3- ® 3PO43- + 4H+ + 5NO

 

Пероксид водорода в окислительно-восстановительных реакциях

 

1.      Обычно пероксид водорода используют как окислитель:

 

H2O2 + 2HI-1 ® I20 + 2H2O

 

электронный баланс:

2I- - 2ē ® I20

1

[O2]-2 + 2ē ® 2O-2

1

 

метод полуреакций:

2I- - 2ē ® I20

1

H2O2 + 2H+ + 2ē ® 2H2O

1

––––––––––––––––––––––

2I- + H2O2 + 2H+ ® I2 + 2H2O

 

При действии сильных окислителей пероксид водорода может окисляться, образуя кислород и воду.

 

5H2O2 + 2KMn+7O4 + 3H2SO4 ® 5O20­ + K2SO4 + 2Mn2+SO4 + 8H2O

 

электронный баланс:

[O2]-2 - 2ē ® O20

5

Mn+7 + 5ē ® Mn+2

2

 

метод полуреакций:

MnO4- + 8H+ + 5ē ® Mn2+ + 4H2O

2

H2O2 - 2ē ® O2 + 2H+

5

––––––––––––––––––––––––––––––––––––––––––

2MnO4- + 5H2O2 + 16H+ ® 2Mn2+ + 8H2O + 5O2 + 10H+

или 2MnO4- + 5H2O2 + 6H+ ® 2Mn2+ + 8H2O + 5O2

 

 

 

МЕНЮ

ВПЕРЕД